EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N8O6S2 |
| Net Charge | 0 |
| Average Mass | 534.580 |
| Monoisotopic Mass | 534.11037 |
| SMILES | [H][C@@]1(N2CC/C(=C\C3=C(C(=O)O)N4C(=O)[C@@]([H])(NC(=O)/C(=N\O)c5nsc(N)n5)[C@@]4([H])SC3)C2=O)CCNC1 |
| InChI | InChI=1S/C20H22N8O6S2/c21-20-24-14(26-36-20)11(25-34)15(29)23-12-17(31)28-13(19(32)33)9(7-35-18(12)28)5-8-2-4-27(16(8)30)10-1-3-22-6-10/h5,10,12,18,22,34H,1-4,6-7H2,(H,23,29)(H,32,33)(H2,21,24,26)/b8-5+,25-11-/t10-,12-,18-/m1/s1 |
| InChIKey | VOAZJEPQLGBXGO-SDAWRPRTSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftobiprole (CHEBI:140407) has role antimicrobial agent (CHEBI:33281) |
| ceftobiprole (CHEBI:140407) is a cephalosporin (CHEBI:23066) |
| ceftobiprole (CHEBI:140407) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(hydroxyimino)acetyl]amino}-3-{(E)-[(3'R)-2-oxo[1,3'-bipyrrolidin]-3-ylidene]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| ceftobiprole | ChemIDplus |
| ceftobiprol | WHO MedNet |
| ceftobiprolum | WHO MedNet |
| ceftobiprole | WHO MedNet |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(hydroxyimino)acetyl]amino}-8-oxo-3-{(E)-[(3'R)-2-oxo[1,3'-bipyrrolidin]-3-ylidene]methyl}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| D08885 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9105776 | Reaxys |
| CAS:209467-52-7 | ChemIDplus |
| Citations |
|---|