EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O7 |
| Net Charge | 0 |
| Average Mass | 276.285 |
| Monoisotopic Mass | 276.12090 |
| SMILES | C[C@H](CC(=O)O)OC(=O)C[C@@H](C)OC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C12H20O7/c1-7(13)4-11(16)19-9(3)6-12(17)18-8(2)5-10(14)15/h7-9,13H,4-6H2,1-3H3,(H,14,15)/t7-,8-,9-/m1/s1 |
| InChIKey | CWLWBMWELZSMPG-IWSPIJDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annulohypoxylon truncatum (ncbitaxon:327061) | - | PubMed (14695807) | |
| Micromonospora sp. RV43 (ncbitaxon:1661387) | - | PubMed (28355070) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) has role fungal metabolite (CHEBI:76946) |
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) is a (3R)-3-hydroxybutanoic acid oligomer (CHEBI:140392) |
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) is a diester (CHEBI:51307) |
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) is conjugate acid of (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoate (CHEBI:140385) |
| Incoming Relation(s) |
| (3R)-3-{[(3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140390) has functional parent (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) |
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoate (CHEBI:140385) is conjugate base of (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid (CHEBI:140388) |
| IUPAC Name |
|---|
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoyl]oxy}butanoic acid |
| Synonym | Source |
|---|---|
| (3R)-3-{[(3R)-3-{[(3R)-3-hydroxybutyryl]oxy}butyryl]oxy}butyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8216073 | Reaxys |
| Citations |
|---|