EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34ClN7O10S2 |
| Net Charge | 0 |
| Average Mass | 752.228 |
| Monoisotopic Mass | 751.14971 |
| SMILES | [H][C@]12SCC(C[N+]3(CCNC(=O)c4ccc(O)c(O)c4Cl)CCCC3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C30H34ClN7O10S2/c1-30(2,28(46)47)48-36-19(16-13-50-29(32)34-16)24(42)35-20-25(43)37-21(27(44)45)14(12-49-26(20)37)11-38(8-3-4-9-38)10-7-33-23(41)15-5-6-17(39)22(40)18(15)31/h5-6,13,20,26H,3-4,7-12H2,1-2H3,(H7-,32,33,34,35,36,39,40,41,42,44,45,46,47)/t20-,26-/m1/s1 |
| InChIKey | DBPPRLRVDVJOCL-FQRUVTKNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefiderocol (CHEBI:140376) has role antibacterial drug (CHEBI:36047) |
| cefiderocol (CHEBI:140376) has role siderophore (CHEBI:26672) |
| cefiderocol (CHEBI:140376) is a carboxylic acid (CHEBI:33575) |
| cefiderocol (CHEBI:140376) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-({1-[2-(2-chloro-3,4-dihydroxybenzamido)ethyl]pyrrolidinium-1-yl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| INNs | Source |
|---|---|
| céfidérocol | WHO MedNet |
| cefiderocol | WHO MedNet |
| cefiderocol | WHO MedNet |
| cefiderocolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| S-649266 | ChEBI |
| S649266 | ChEBI |
| S 649266 | ChemIDplus |
| GSK 2696266 | ChemIDplus |
| GSK-2696266 | ChEBI |
| GSK2696266 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21605074 | Reaxys |
| CAS:1225208-94-5 | ChemIDplus |
| Citations |
|---|