EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N10O19P4 |
| Net Charge | 0 |
| Average Mass | 836.391 |
| Monoisotopic Mass | 836.04827 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O[C@@H]2[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]2n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H28N10O19P4/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(45-19)1-43-51(37,38)47-14-12(32)8(2-44-52(39,40)49-53(41,42)48-50(34,35)36)46-20(14)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-33H,1-2H2,(H,37,38)(H,39,40)(H,41,42)(H2,21,23,25)(H2,22,24,26)(H2,34,35,36)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | YHHSPPDBQDMAPZ-XPWFQUROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (2960522) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-triphosphoadenylyl-(2'→5')-adenosine (CHEBI:140314) has role antiviral agent (CHEBI:22587) |
| 5'-triphosphoadenylyl-(2'→5')-adenosine (CHEBI:140314) has role bacterial metabolite (CHEBI:76969) |
| 5'-triphosphoadenylyl-(2'→5')-adenosine (CHEBI:140314) is a (2'→5')-dinucleotide (CHEBI:75800) |
| 5'-triphosphoadenylyl-(2'→5')-adenosine (CHEBI:140314) is conjugate acid of 5'-triphosphoadenylyl-(2'→5')-adenosine(5−) (CHEBI:140294) |
| Incoming Relation(s) |
| 5'-triphosphoadenylyl-(2'→5')-adenosine(5−) (CHEBI:140294) is conjugate base of 5'-triphosphoadenylyl-(2'→5')-adenosine (CHEBI:140314) |
| Synonym | Source |
|---|---|
| pppA2'p5'A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4646833 | Reaxys |
| Citations |
|---|