EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | Nc1c(O)cc(O)cc1C(=O)O |
| InChI | InChI=1S/C7H7NO4/c8-6-4(7(11)12)1-3(9)2-5(6)10/h1-2,9-10H,8H2,(H,11,12) |
| InChIKey | FNJVIEZDTMREOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dihydroxyanthranilic acid (CHEBI:1403) has functional parent anthranilic acid (CHEBI:30754) |
| 3,5-dihydroxyanthranilic acid (CHEBI:1403) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3,5-dihydroxyanthranilic acid (CHEBI:1403) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-amino-3,5-dihydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3,5-Dihydroxyanthranilate | KEGG COMPOUND |
| 3,5-Dihydroxyanthranilic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11465 | KEGG COMPOUND |