EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N2O6S |
| Net Charge | -1 |
| Average Mass | 253.256 |
| Monoisotopic Mass | 253.04998 |
| SMILES | [NH3+][C@@H](CCC(=O)NCCS(=O)(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O6S/c8-5(7(11)12)1-2-6(10)9-3-4-16(13,14)15/h5H,1-4,8H2,(H,9,10)(H,11,12)(H,13,14,15)/p-1/t5-/m0/s1 |
| InChIKey | WGXUDTHMEITUBO-YFKPBYRVSA-M |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutaurine(1−) (CHEBI:140299) has role anticonvulsant (CHEBI:35623) |
| glutaurine(1−) (CHEBI:140299) has role anxiolytic drug (CHEBI:35474) |
| glutaurine(1−) (CHEBI:140299) has role hormone (CHEBI:24621) |
| glutaurine(1−) (CHEBI:140299) is a organosulfonate oxoanion (CHEBI:33554) |
| glutaurine(1−) (CHEBI:140299) is conjugate base of glutaurine zwitterion (CHEBI:140298) |
| Incoming Relation(s) |
| glutaurine zwitterion (CHEBI:140298) is conjugate acid of glutaurine(1−) (CHEBI:140299) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-oxo-5-[(2-sulfonatoethyl)amino]pentanoate |