EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O5 |
| Net Charge | 0 |
| Average Mass | 410.470 |
| Monoisotopic Mass | 410.18417 |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1Cc2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C23H26N2O5/c1-15(24-19(22(27)28)12-11-16-7-3-2-4-8-16)21(26)25-14-18-10-6-5-9-17(18)13-20(25)23(29)30/h2-10,15,19-20,24H,11-14H2,1H3,(H,27,28)(H,29,30)/t15-,19-,20-/m0/s1 |
| InChIKey | FLSLEGPOVLMJMN-YSSFQJQWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinaprilat (CHEBI:140296) has role antihypertensive agent (CHEBI:35674) |
| quinaprilat (CHEBI:140296) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| quinaprilat (CHEBI:140296) has role vasodilator agent (CHEBI:35620) |
| quinaprilat (CHEBI:140296) is a dicarboxylic acid (CHEBI:35692) |
| quinaprilat (CHEBI:140296) is a isoquinolines (CHEBI:24922) |
| quinaprilat (CHEBI:140296) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (3S)-2-{N-[(1S)-1-carboxy-3-phenylpropyl]-L-alanyl}-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| quinaprilat | WHO MedNet |
| quinaprilat | ChemIDplus |
| quinaprilate | WHO MedNet |
| quinaprilatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CI 928 | ChemIDplus |
| CI-928 | ChemIDplus |
| CI928 | ChEBI |
| CL-928 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 97106 | ChemSpider |
| C21540 | KEGG COMPOUND |
| D03773 | KEGG DRUG |
| HMDB0042005 | HMDB |
| Quinaprilat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5653070 | Reaxys |
| CAS:82768-85-2 | ChemIDplus |
| Citations |
|---|