EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27O4 |
| Net Charge | -1 |
| Average Mass | 331.432 |
| Monoisotopic Mass | 331.19148 |
| SMILES | CC/C=C\C[C@H](O)C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H28O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h3-4,6-7,12,14-17,21H,2,5,8-11,13H2,1H3,(H,23,24)/p-1/b6-3-,7-4-,18-14+/t16-,17-/m0/s1 |
| InChIKey | MSLYURLMFHGOET-OLBAJUCDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ12-prostaglandin J3(1−) (CHEBI:140288) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| Δ12-prostaglandin J3(1−) (CHEBI:140288) is conjugate base of Δ12-prostaglandin J3 (CHEBI:140274) |
| Incoming Relation(s) |
| Δ12-prostaglandin J3 (CHEBI:140274) is conjugate acid of Δ12-prostaglandin J3(1−) (CHEBI:140288) |
| IUPAC Name |
|---|
| (5Z)-7-{(1S,5E)-5-[(3S,5Z)-3-hydroxyoct-5-en-1-ylidene]-4-oxocyclopent-2-en-1-yl}hept-5-enoate |
| Synonyms | Source |
|---|---|
| (5Z,9Z,12E,15S,17Z)-15-hydroxy-11-oxoprostatetraenoate | ChEBI |
| delta-12-PGJ3(1−) | ChEBI |
| δ(12)-PGJ3(1−) | ChEBI |
| δ(12)-prostaglandin J3(1−) | ChEBI |
| Δ(12)-prostaglandin J3(1−) | ChEBI |