EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25O3 |
| Net Charge | -1 |
| Average Mass | 313.417 |
| Monoisotopic Mass | 313.18092 |
| SMILES | CC/C=C\C/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H26O3/c1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23/h3-4,6-7,9-10,13,15-17H,2,5,8,11-12,14H2,1H3,(H,22,23)/p-1/b4-3-,9-7-,10-6+,18-13+/t17-/m0/s1 |
| InChIKey | QFTYCAAGCUOJNG-KRXWQEJVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-deoxy-Δ12,14-prostaglandin J3(1−) (CHEBI:140283) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 15-deoxy-Δ12,14-prostaglandin J3(1−) (CHEBI:140283) is conjugate base of 15-deoxy-Δ12,14-prostaglandin J3 (CHEBI:140223) |
| Incoming Relation(s) |
| 15-deoxy-Δ12,14-prostaglandin J3 (CHEBI:140223) is conjugate acid of 15-deoxy-Δ12,14-prostaglandin J3(1−) (CHEBI:140283) |
| IUPAC Name |
|---|
| (5Z)-7-{(1S,5E)-5-[(2E,5Z)-octa-2,5-dien-1-ylidene]-4-oxocyclopent-2-en-1-yl}hept-5-enoate |
| Synonyms | Source |
|---|---|
| 15-deoxyprostaglandin J3(1−) | ChEBI |
| 15-deoxy-δ(12,14)-prostaglandin J3(1−) | ChEBI |
| 15d-PGJ3(1−) | ChEBI |
| (5Z,12E,14E,17Z)-11-oxoprosta-5,9,12,14,17-pentaen-1-oate | ChEBI |