EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(C=C3C)CC[C@]1([H])C(C)(C)[C@H](O)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C20H32O2/c1-12-9-20-8-7-15-18(2,3)17(22)14(21)11-19(15,4)16(20)6-5-13(12)10-20/h9,13-17,21-22H,5-8,10-11H2,1-4H3/t13-,14-,15-,16+,17-,19-,20-/m1/s1 |
| InChIKey | WNDMUTXXXQEUPV-VWZCVCQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (21985968) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3α-dihydroxy-ent-isokaurene (CHEBI:140275) has role plant metabolite (CHEBI:76924) |
| 2α,3α-dihydroxy-ent-isokaurene (CHEBI:140275) is a ent-kaurane diterpenoid (CHEBI:36760) |
| UniProt Name | Source |
|---|---|
| ent-isokaurene-2β,3β-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20322 | MetaCyc |
| Citations |
|---|