EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | CC/C=C\CC(O)/C=C/C=CCC=C/C=C\C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C22H34O4/c1-2-3-10-15-20(23)16-11-7-5-4-6-8-12-17-21(24)18-13-9-14-19-22(25)26/h3,5-8,10-12,16-17,20-21,23-24H,2,4,9,13-15,18-19H2,1H3,(H,25,26)/b7-5?,8-6?,10-3-,16-11+,17-12- |
| InChIKey | JUBMLVBCKBUAQW-RULBWSPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23736886) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoic acid (CHEBI:140273) has role human xenobiotic metabolite (CHEBI:76967) |
| 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoic acid (CHEBI:140273) has role specialised pro-resolving mediator (CHEBI:140399) |
| 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoic acid (CHEBI:140273) is a DiHDPE (CHEBI:72656) |
| 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoic acid (CHEBI:140273) is conjugate acid of 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoate (CHEBI:140419) |
| Incoming Relation(s) |
| 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoate (CHEBI:140419) is conjugate base of 7,17-dihydroxy-(8Z,15E,19Z)-docosa-8,10,13,15,19-pentaenoic acid (CHEBI:140273) |
| IUPAC Name |
|---|
| (8Z,15E,19Z)-7,17-dihydroxydocosa-8,10,13,15,19-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 7,17-dihydroxy-(8Z,10,13,15E,19Z)-docosapentaenoic acid | ChEBI |
| 7,17-dihydroxy-omega3-docosapentaenoic acid | ChEBI |
| 7,17-dihydroxy-ω3-docosapentaenoic acid | ChEBI |
| resolvin D5n-3 DPA | ChEBI |
| RvD5n-3 DPA | SUBMITTER |
| Citations |
|---|