EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40N2O7S |
| Net Charge | 0 |
| Average Mass | 536.691 |
| Monoisotopic Mass | 536.25562 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=CC=C[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C27H40N2O7S/c1-2-3-9-14-21(30)15-10-6-4-5-7-12-17-24(23(31)16-11-8-13-18-25(32)33)37-20-22(28)27(36)29-19-26(34)35/h3-12,15,17,21-24,30-31H,2,13-14,16,18-20,28H2,1H3,(H,29,36)(H,32,33)(H,34,35)/b6-4-,7-5?,9-3-,11-8-,15-10+,17-12?/t21-,22-,23+,24-/m0/s1 |
| InChIKey | RJHKUGKYEOVVKD-HTWGBIMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25713027) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) has role human xenobiotic metabolite (CHEBI:76967) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) has role specialised pro-resolving mediator (CHEBI:140399) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is a dicarboxylic acid (CHEBI:35692) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is a dipeptide (CHEBI:46761) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is a docosanoid (CHEBI:131863) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is a organic sulfide (CHEBI:16385) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is a secondary allylic alcohol (CHEBI:134396) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) is conjugate acid of (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoate(1−) (CHEBI:140412) |
| Incoming Relation(s) |
| (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoate(1−) (CHEBI:140412) is conjugate base of (8S)-glycinylcystein-S-yl-(7R,17S)-dihydroxy-(4Z,9,11,13Z,15E,19Z)-docosahexaenoic acid (CHEBI:140269) |
| IUPAC Name |
|---|
| S-[(3Z,6R,7S,12Z,14E,16S,18Z)-1-carboxy-6,16-dihydroxyhenicosa-3,8,10,12,14,18-hexaen-7-yl]-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| 8-cysteinylglycinyl-7,17-dihydroxydocosahexaenoic acid | ChEBI |
| RCTR2 | SUBMITTER |
| resolvin conjugate in tissue regeneration 2 | SUBMITTER |