EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O4/c1-2-3-6-10-17(21)13-14-18-16(12-15-19(18)22)9-7-4-5-8-11-20(23)24/h3-4,6-7,12-18,21H,2,5,8-11H2,1H3,(H,23,24)/b6-3-,7-4-,14-13+/t16-,17-,18+/m0/s1 |
| InChIKey | DIBKBAMSPPKSTJ-BAILPSPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22442337) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin J3 (CHEBI:140267) has role antineoplastic agent (CHEBI:35610) |
| prostaglandin J3 (CHEBI:140267) has role human xenobiotic metabolite (CHEBI:76967) |
| prostaglandin J3 (CHEBI:140267) is a prostaglandins J (CHEBI:26346) |
| prostaglandin J3 (CHEBI:140267) is a secondary allylic alcohol (CHEBI:134396) |
| prostaglandin J3 (CHEBI:140267) is conjugate acid of prostaglandin J3(1−) (CHEBI:140285) |
| Incoming Relation(s) |
| Δ12-prostaglandin J3 (CHEBI:140274) has functional parent prostaglandin J3 (CHEBI:140267) |
| prostaglandin J3(1−) (CHEBI:140285) is conjugate base of prostaglandin J3 (CHEBI:140267) |
| IUPAC Name |
|---|
| (5Z)-7-{(1S,5R)-5-[(1E,3S,5Z)-3-hydroxyocta-1,5-dien-1-yl]-4-oxocyclopent-2-en-1-yl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| 15S-hydroxy-11-oxo-5Z,9Z,13E,17Z-prostatetraenoic acid | LIPID MAPS |
| (5Z,9Z,13E,15S,17Z)-15-hydroxy-11-oxoprostatetraenoic acid | ChEBI |
| PGJ3 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 16061112 | PubChem Compound |
| LMFA03010180 | LIPID MAPS |
| Citations |
|---|