EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47N3O9S |
| Net Charge | 0 |
| Average Mass | 649.807 |
| Monoisotopic Mass | 649.30330 |
| SMILES | CC/C=C\C[C@@H](O)[C@H](C=CC=CC=CC/C=C\C/C=C\CCC(=O)O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C32H47N3O9S/c1-2-3-14-17-26(36)27(18-15-12-10-8-6-4-5-7-9-11-13-16-19-29(38)39)45-23-25(31(42)34-22-30(40)41)35-28(37)21-20-24(33)32(43)44/h3,5-8,10-15,18,24-27,36H,2,4,9,16-17,19-23,33H2,1H3,(H,34,42)(H,35,37)(H,38,39)(H,40,41)(H,43,44)/b7-5-,8-6?,12-10?,13-11-,14-3-,18-15?/t24-,25-,26+,27-/m0/s1 |
| InChIKey | RYALZZFZNGJXAF-AKGNYEKSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) has role human xenobiotic metabolite (CHEBI:76967) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) has role specialised pro-resolving mediator (CHEBI:140399) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is a docosanoid (CHEBI:131863) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is a glutathione conjugate (CHEBI:24335) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is a organic sulfide (CHEBI:16385) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is a secondary alcohol (CHEBI:35681) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is a tricarboxylic acid (CHEBI:27093) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) is conjugate acid of 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoate(2−) (CHEBI:140394) |
| Incoming Relation(s) |
| 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoate(2−) (CHEBI:140394) is conjugate base of 16(S)-glutathionyl-17(R)-hydroxy-(4Z,7Z,10,12,14,19Z)-docosahexaenoic acid (CHEBI:140262) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[(3Z,6R,7S,15Z,18Z)-21-carboxy-6-hydroxyhenicosa-3,8,10,12,15,18-hexaen-7-yl]-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| PCTR1 | SUBMITTER |
| protectin conjugate in tissue regeneration 1 | SUBMITTER |
| 16-glutathionyl-17-hydroxy-4Z,7Z,10,12,14,19Z-docosahexaenoic acid | ChEBI |
| Citations |
|---|