EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]1([H])C[C@@]1(CO)[C@]3(C(=O)O)C(C(C)C)=C[C@@]1([H])C[C@]23C=O |
| InChI | InChI=1S/C20H28O4/c1-11(2)16-6-13-7-19(10-22)15-5-4-12(3)14(15)8-18(13,9-21)20(16,19)17(23)24/h6,10-15,21H,4-5,7-9H2,1-3H3,(H,23,24)/t12-,13+,14-,15-,18+,19+,20-/m1/s1 |
| InChIKey | QIMCUSGGYZHVEF-VULLPXFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora pleiospora (ncbitaxon:261701) | - | PubMed (16018317) | |
| Xylaria sp. (ncbitaxon:1715255) | - | PubMed (18495187) | Strain: PSU-D14 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sordaricin (CHEBI:140259) has role antifungal agent (CHEBI:35718) |
| sordaricin (CHEBI:140259) has role fungal metabolite (CHEBI:76946) |
| sordaricin (CHEBI:140259) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| sordaricin (CHEBI:140259) is a aldehyde (CHEBI:17478) |
| sordaricin (CHEBI:140259) is a bridged compound (CHEBI:35990) |
| sordaricin (CHEBI:140259) is a primary alcohol (CHEBI:15734) |
| sordaricin (CHEBI:140259) is a tetracyclic diterpenoid (CHEBI:52557) |
| sordaricin (CHEBI:140259) is conjugate acid of sordaricin(1−) (CHEBI:140232) |
| Incoming Relation(s) |
| sordaricin(1−) (CHEBI:140232) is conjugate base of sordaricin (CHEBI:140259) |
| IUPAC Name |
|---|
| (1R,3aR,4S,4aR,7R,7aR,8aS)-4-formyl-8a-(hydroxymethyl)-7-methyl-3-(propan-2-yl)-4,4a,5,6,7,7a,8,8a-octahydro-1,4-methano-s-indacene-3a(1H)-carboxylic acid |
| Synonym | Source |
|---|---|
| (-)-Sordaricin | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00034268 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8005741 | Reaxys |
| CAS:51493-69-7 | ChemIDplus |
| Citations |
|---|