EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(=O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-21(23)19-16-14-17-20-22(24)25/h3-4,6-7,9-10,12-16,18H,2,5,8,11,17,19-20H2,1H3,(H,24,25)/b4-3-,7-6-,10-9-,13-12-,16-14-,18-15+ |
| InChIKey | SITZAHBLAZBWRW-XJAVJPOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26339618) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) has role human xenobiotic metabolite (CHEBI:76967) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) is a enone (CHEBI:51689) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) is a oxodocosahexaenoic acid (CHEBI:134542) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) is conjugate acid of (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoate (CHEBI:140382) |
| Incoming Relation(s) |
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoate (CHEBI:140382) is conjugate base of (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosahexaenoic acid (CHEBI:140252) |
| IUPAC Name |
|---|
| (4Z,8E,10Z,13Z,16Z,19Z)-7-oxodocosa-4,8,10,13,16,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| (4Z,8E,10Z,13Z,16Z,19Z)-7-ketodocosahexaenoic acid | ChEBI |
| 7-oxo-(4Z,8E,10Z,13Z,16Z,19Z)-docosahexaenoic acid | ChEBI |
| 7-oxo-DHA | SUBMITTER |
| 7-oxodocosahexaenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27937080 | Reaxys |
| Citations |
|---|