EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h3-4,6-7,9-10,12-14,16H,2,5,8,11,15,17-18H2,1H3,(H,22,23)/b4-3-,7-6-,10-9-,13-12-,16-14+ |
| InChIKey | KVLNCELNGBMHDX-FCWZHQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26339618) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) has functional parent all-cis-5,8,11,14,17-icosapentaenoic acid (CHEBI:28364) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is a enone (CHEBI:51689) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is a icosanoid (CHEBI:23899) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is a long-chain fatty acid (CHEBI:15904) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is a oxo fatty acid (CHEBI:59644) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is a polyunsaturated fatty acid (CHEBI:26208) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) is conjugate acid of (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoate (CHEBI:140337) |
| Incoming Relation(s) |
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoate (CHEBI:140337) is conjugate base of (6E,8Z,11Z,14Z,17Z)-5-oxoicosapentaenoic acid (CHEBI:140244) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z,17Z)-5-oxoicosa-6,8,11,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 5-oxo-EPA | SUBMITTER |
| 5-oxoeicosapentaenoic acid | ChEBI |
| 5-oxo-EPE | ChEBI |
| (6E,8Z,11Z,14Z,17Z)-5-oxoeicosapentaenoic acid | ChEBI |
| 5-oxo-(6E,8Z,11Z,14Z,17Z)-eicosapentaenoic acid | ChEBI |
| 5-oxoicosapentaenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15801996 | Reaxys |
| Citations |
|---|