EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37O8 |
| Net Charge | -1 |
| Average Mass | 477.574 |
| Monoisotopic Mass | 477.24939 |
| SMILES | [H][C@@]1(OC[C@@]23C[C@]4([H])[C@H](C)CC[C@@]4([H])[C@@]4(C=O)C[C@]2([H])C=C(C(C)C)[C@]43C(=O)[O-])O[C@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H38O8/c1-12(2)18-7-15-8-24(10-27)17-6-5-13(3)16(17)9-25(15,26(18,24)23(31)32)11-33-22-21(30)20(29)19(28)14(4)34-22/h7,10,12-17,19-22,28-30H,5-6,8-9,11H2,1-4H3,(H,31,32)/p-1/t13-,14-,15+,16-,17-,19-,20-,21+,22-,24+,25+,26+/m1/s1 |
| InChIKey | YTWDSZAPPKUSFS-OIAXQXJYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-demethylsordarin(1−) (CHEBI:140233) is a 3-oxo monocarboxylic acid anion (CHEBI:35973) |
| 4'-O-demethylsordarin(1−) (CHEBI:140233) is conjugate base of 4'-O-demethylsordarin (CHEBI:140297) |
| Incoming Relation(s) |
| 4'-O-demethylsordarin (CHEBI:140297) is conjugate acid of 4'-O-demethylsordarin(1−) (CHEBI:140233) |
| IUPAC Name |
|---|
| (1R,3aR,4S,4aR,7R,7aR,8aS)-8a-{[(6-deoxy-β-D-altropyranosyl)oxy]methyl}-4-formyl-7-methyl-3-(propan-2-yl)-4,4a,5,6,7,7a,8,8a-octahydro-1,4-methano-s-indacene-3a(1H)-carboxylate |
| UniProt Name | Source |
|---|---|
| 4'-O-demethylsordarin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20459 | MetaCyc |
| Citations |
|---|