EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O6 |
| Net Charge | 0 |
| Average Mass | 392.492 |
| Monoisotopic Mass | 392.21989 |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C/C=C\C=C\[C@H](C/C=C\CCC(=O)O)OO)OO |
| InChI | InChI=1S/C22H32O6/c1-2-3-4-5-6-10-15-20(27-25)16-11-7-8-12-17-21(28-26)18-13-9-14-19-22(23)24/h3-4,6-13,16-17,20-21,25-26H,2,5,14-15,18-19H2,1H3,(H,23,24)/b4-3-,8-7-,10-6-,13-9-,16-11+,17-12+/t20-,21+/m0/s1 |
| InChIKey | LWOCSKALTQGXLZ-VDBKHXQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (19103881) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S,14S)-bis(hydroperoxy)-(4Z,8E,10Z,12E,16Z,19Z)-docosahexaenoic acid (CHEBI:140196) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| (7S,14S)-bis(hydroperoxy)-(4Z,8E,10Z,12E,16Z,19Z)-docosahexaenoic acid (CHEBI:140196) has role human xenobiotic metabolite (CHEBI:76967) |
| (7S,14S)-bis(hydroperoxy)-(4Z,8E,10Z,12E,16Z,19Z)-docosahexaenoic acid (CHEBI:140196) is a docosanoid (CHEBI:131863) |
| (7S,14S)-bis(hydroperoxy)-(4Z,8E,10Z,12E,16Z,19Z)-docosahexaenoic acid (CHEBI:140196) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| (7S,14S)-bis(hydroperoxy)-(4Z,8E,10Z,12E,16Z,19Z)-docosahexaenoic acid (CHEBI:140196) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4Z,7S,8E,10Z,12E,14S,16Z,19Z)-7,14-bis(hydroperoxy)docosa-4,8,10,12,16,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 7(S),14(S)-diHpDHA | ChEBI |
| (4Z,7S,8E,10Z,12E,14S,16Z,19Z)-7,14-bis(hydroperoxy)docosahexaenoic acid | ChEBI |
| 7(S),14(S)-diHp-DHA | SUBMITTER |
| Citations |
|---|