EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(C=C3C)CC[C@]1([H])C(C)(C)C[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C20H32O/c1-13-9-20-8-7-16-18(2,3)11-15(21)12-19(16,4)17(20)6-5-14(13)10-20/h9,14-17,21H,5-8,10-12H2,1-4H3/t14-,15+,16-,17+,19-,20-/m1/s1 |
| InChIKey | KMRGROLDAASNIW-UELOQWINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (21985968) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-hydroxy-ent-isokaurene (CHEBI:140188) has role plant metabolite (CHEBI:76924) |
| 2α-hydroxy-ent-isokaurene (CHEBI:140188) is a ent-kaurane diterpenoid (CHEBI:36760) |
| IUPAC Name |
|---|
| (2S,4aR,6aS,9R,11aS,11bR)-4,4,8,11b-tetramethyl-1,2,3,4,4a,5,6,9,10,11,11a,11b-dodecahydro-6a,9-methanocyclohepta[a]naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 5β,8α,9β,10α,13α-kaur-15-en-2α-ol | IUPAC |
| ent-2β-hydroxyisokaurene | ChEBI |
| ent-isokauren-2β-ol | MetaCyc |
| UniProt Name | Source |
|---|---|
| ent-isokauren-2β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20323 | MetaCyc |
| Citations |
|---|