EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13N3O3S |
| Net Charge | 0 |
| Average Mass | 315.354 |
| Monoisotopic Mass | 315.06776 |
| SMILES | COC(=O)Nc1nc2ccc(Sc3ccc(O)cc3)cc2n1 |
| InChI | InChI=1S/C15H13N3O3S/c1-21-15(20)18-14-16-12-7-6-11(8-13(12)17-14)22-10-4-2-9(19)3-5-10/h2-8,19H,1H3,(H2,16,17,18,20) |
| InChIKey | KFNQNAKZKBFJAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anas platyrhynchos (ncbitaxon:8839) | liver (BTO:0000759) | PubMed (3212936) | |
| Bos taurus (ncbitaxon:9913) | liver (BTO:0000759) | PubMed (3212936) | |
| Capra hircus (ncbitaxon:9925) | liver (BTO:0000759) | PubMed (3212936) | |
| Gallus gallus (ncbitaxon:9031) | liver (BTO:0000759) | PubMed (3212936) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23959307) | |
| Ictalurus punctatus (ncbitaxon:7998) | liver (BTO:0000759) | PubMed (2382406) | |
| Meleagris gallopavo (ncbitaxon:9103) | liver (BTO:0000759) | PubMed (3212936) | |
| Oryctolagus cuniculus (ncbitaxon:9986) | liver (BTO:0000759) | PubMed (3212936) | |
| Ovis aries (ncbitaxon:9940) | liver (BTO:0000759) | PubMed (3212936) | |
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | PubMed (3212936) |
| Roles Classification |
|---|
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyfenbendazole (CHEBI:140184) has functional parent fenbendazole (CHEBI:77092) |
| hydroxyfenbendazole (CHEBI:140184) has role drug metabolite (CHEBI:49103) |
| hydroxyfenbendazole (CHEBI:140184) has role marine xenobiotic metabolite (CHEBI:83399) |
| hydroxyfenbendazole (CHEBI:140184) is a aryl sulfide (CHEBI:35683) |
| hydroxyfenbendazole (CHEBI:140184) is a benzimidazoles (CHEBI:22715) |
| hydroxyfenbendazole (CHEBI:140184) is a carbamate ester (CHEBI:23003) |
| hydroxyfenbendazole (CHEBI:140184) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| 4-Hydroxyfenbendazole | ChemIDplus |
| 5-(p-Hydroxyphenyl)thio-2-carbomethoxyaminobenzimidazole | ChemIDplus |
| Fbz-OH | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4'-hydroxyfenbendazole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20525 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395578 | Reaxys |
| CAS:72447-64-4 | ChemIDplus |
| Citations |
|---|