EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O5 |
| Net Charge | 0 |
| Average Mass | 376.408 |
| Monoisotopic Mass | 376.13107 |
| SMILES | COc1cc(O)c(Cc2ccccc2O)c2c1C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C23H20O5/c1-27-21-12-18(25)16(11-15-9-5-6-10-17(15)24)23-22(21)19(26)13-20(28-23)14-7-3-2-4-8-14/h2-10,12,20,24-25H,11,13H2,1H3 |
| InChIKey | KKEXONXLVLHEJJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-methylchamanetin (CHEBI:140136) is a diarylheptanoid (CHEBI:78802) |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140148 | LIPID MAPS |