EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N5O9P |
| Net Charge | 0 |
| Average Mass | 457.336 |
| Monoisotopic Mass | 457.09986 |
| SMILES | Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)c2cc1N |
| InChI | InChI=1S/C16H20N5O9P/c1-6-2-8-9(3-7(6)17)21(14-12(18-8)15(25)20-16(26)19-14)4-10(22)13(24)11(23)5-30-31(27,28)29/h2-3,10-11,13,22-24H,4-5,17H2,1H3,(H,20,25,26)(H2,27,28,29)/t10-,11+,13-/m0/s1 |
| InChIKey | LFSZWRDSWJUUAL-LOWVWBTDSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-amino-8-demethylriboflavin 5'-phosphate (CHEBI:140135) has functional parent 8-amino-8-demethylriboflavin (CHEBI:137336) |
| 8-amino-8-demethylriboflavin 5'-phosphate (CHEBI:140135) is a flavin mononucleotide (CHEBI:24041) |
| 8-amino-8-demethylriboflavin 5'-phosphate (CHEBI:140135) is a ribitol phosphate (CHEBI:26554) |
| 8-amino-8-demethylriboflavin 5'-phosphate (CHEBI:140135) is conjugate acid of 8-amino-8-demethylriboflavin 5'-phosphate(3−) (CHEBI:139569) |
| Incoming Relation(s) |
| 8-amino-8-demethylriboflavin 5'-phosphate(3−) (CHEBI:139569) is conjugate base of 8-amino-8-demethylriboflavin 5'-phosphate (CHEBI:140135) |
| IUPAC Name |
|---|
| 1-(8-amino-7-methyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-1-deoxy-5-O-phosphono-D-ribitol |
| Manual Xrefs | Databases |
|---|---|
| CPD-19836 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29711595 | Reaxys |
| Citations |
|---|