EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N8O8S3 |
| Net Charge | 0 |
| Average Mass | 594.613 |
| Monoisotopic Mass | 594.04097 |
| SMILES | [H]C(=O)Cn1c(S/C=C/C2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)/C(=N\OC)c4csc(N)n4)[C@@]3([H])SC2)nnc(=O)c1=O |
| InChI | InChI=1S/C20H18N8O8S3/c1-36-26-10(9-7-39-19(21)22-9)13(30)23-11-15(32)28-12(18(34)35)8(6-38-17(11)28)2-5-37-20-25-24-14(31)16(33)27(20)3-4-29/h2,4-5,7,11,17H,3,6H2,1H3,(H2,21,22)(H,23,30)(H,24,31)(H,34,35)/b5-2+,26-10-/t11-,17-/m1/s1 |
| InChIKey | WJXAHFZIHLTPFR-JLRJEBFFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftiolene (CHEBI:140116) has role antibacterial drug (CHEBI:36047) |
| ceftiolene (CHEBI:140116) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| 3-[(E)-2-{[5,6-dioxo-4-(2-oxoethyl)-1,4,5,6-tetrahydro-1,2,4-triazin-3-yl]sulfanyl}ethenyl]-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxyic acid |
| INNs | Source |
|---|---|
| ceftiolene | WHO MedNet |
| ceftioléne | WHO MedNet |
| ceftioleno | WHO MedNet |
| ceftiolenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(E)-2-{[5,6-dioxo-4-(2-oxoethyl)-1,4,5,6-tetrahydro-1,2,4-triazin-3-yl]sulfanyl}ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| 42980RP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Ceftiolene | Wikipedia |
| 5020599 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:77360-52-2 | ChemIDplus |
| Citations |
|---|