EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28NO4.CH3O4S |
| Net Charge | 0 |
| Average Mass | 457.545 |
| Monoisotopic Mass | 457.17704 |
| SMILES | COS(=O)(=O)[O-].[H][C@]12CC[C@]([H])(CC(OC(=O)C(C(=O)OCC)c3ccccc3)C1)[N+]2(C)C |
| InChI | InChI=1S/C20H28NO4.CH4O4S/c1-4-24-19(22)18(14-8-6-5-7-9-14)20(23)25-17-12-15-10-11-16(13-17)21(15,2)3;1-5-6(2,3)4/h5-9,15-18H,4,10-13H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1/t15-,16+,17?,18?; |
| InChIKey | YLMCBOIUJONUGH-JFHFZLIBSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tematropium methylsulfate (CHEBI:140113) is a tropane alkaloid (CHEBI:37332) |
| Manual Xrefs | Databases |
|---|---|
| D06061 | KEGG DRUG |