EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:140109 - cefdaloxime
| Formula | C14H15N5O6S2 |
| Net Charge | 0 |
| Average Mass | 413.437 |
| Monoisotopic Mass | 413.04638 |
| SMILES | [H][C@]12SCC(COC)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\O)c1csc(N)n1 |
| InChI | InChI=1S/C14H15N5O6S2/c1-25-2-5-3-26-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-27-14(15)16-6/h4,8,12,24H,2-3H2,1H3,(H2,15,16)(H,17,20)(H,22,23)/b18-7-/t8-,12-/m1/s1 |
| InChIKey | HOGISBSFFHDTRM-GHXIOONMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefdaloxime (CHEBI:140109) has role antibacterial drug (CHEBI:36047) |
| cefdaloxime (CHEBI:140109) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| 3-(methoxymethyl)-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(hydroxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefdaloxime | ChemIDplus |
| cefdaloximum | ChemIDplus |
| cefdaloxima | ChemIDplus |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(hydroxyimino)acetyl]amino}-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Cefdaloxime | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7608234 | Reaxys |
| CAS:80195-36-4 | ChemIDplus |
| Citations |
|---|