EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38O16 |
| Net Charge | 0 |
| Average Mass | 666.629 |
| Monoisotopic Mass | 666.21599 |
| SMILES | COc1cc(OC)c2c(=O)c(O[C@@H]3O[C@H](CO[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H38O16/c1-12-21(32)24(35)26(37)30(44-12)43-11-19-22(33)25(36)27(38)31(46-19)47-29-23(34)20-17(42-5)9-14(39-2)10-18(20)45-28(29)13-6-7-15(40-3)16(8-13)41-4/h6-10,12,19,21-22,24-27,30-33,35-38H,11H2,1-5H3/t12-,19+,21-,22+,24+,25-,26+,27+,30+,31-/m0/s1 |
| InChIKey | MEJNXDYVXPUWEN-MVXJRKCZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fagopyrum tataricum (ncbitaxon:62330) | - | PubMed (27104519) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7,3',4'-tetramethylquercetin-3-O-rutinoside (CHEBI:140106) has functional parent quercetin 5,7,3',4'-tetramethyl ether (CHEBI:85124) |
| 5,7,3',4'-tetramethylquercetin-3-O-rutinoside (CHEBI:140106) has role plant metabolite (CHEBI:76924) |
| 5,7,3',4'-tetramethylquercetin-3-O-rutinoside (CHEBI:140106) is a disaccharide derivative (CHEBI:63353) |
| 5,7,3',4'-tetramethylquercetin-3-O-rutinoside (CHEBI:140106) is a rutinoside (CHEBI:26587) |
| 5,7,3',4'-tetramethylquercetin-3-O-rutinoside (CHEBI:140106) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-1-benzopyran-4-one | CAS |
| 5,7,3',4'-tetramethylquercetine-3-O-rutinoside | ChEBI |
| quercetin 5,7,3',4'-tetramethyl ether 3-rutinoside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00005625 | KNApSAcK |
| FDB018890 | FooDB |
| LMPK12112764 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:58528-03-3 | CAS |
| Citations |
|---|