EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36N5O18P |
| Net Charge | 0 |
| Average Mass | 773.598 |
| Monoisotopic Mass | 773.17930 |
| SMILES | C[C@H](OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H36N5O18P/c1-12(25(42)31-17(28(46)47)4-6-21(38)30-16(27(44)45)5-7-22(39)40)52-53(49,50)51-11-20(37)23(41)19(36)10-34-18-9-14(35)3-2-13(18)8-15-24(34)32-29(48)33-26(15)43/h2-3,8-9,12,16-17,19-20,23,35-37,41H,4-7,10-11H2,1H3,(H,30,38)(H,31,42)(H,39,40)(H,44,45)(H,46,47)(H,49,50)(H,33,43,48)/t12-,16-,17-,19-,20+,23-/m0/s1 |
| InChIKey | GEHSZWRGPHDXJO-NALJQGANSA-N |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme γ-F420-2 (CHEBI:16848) has functional parent 7,8-didemethyl-8-hydroxy-5-deazariboflavin (CHEBI:43034) |
| coenzyme γ-F420-2 (CHEBI:16848) has role coenzyme (CHEBI:23354) |
| coenzyme γ-F420-2 (CHEBI:16848) is a pyrimidoquinolines (CHEBI:59535) |
| coenzyme γ-F420-2 (CHEBI:16848) is a ribitol phosphate (CHEBI:26554) |
| coenzyme γ-F420-2 (CHEBI:16848) is conjugate acid of coenzyme γ-F420-2(4−) (CHEBI:59541) |
| coenzyme γ-F420-2 (CHEBI:16848) is conjugate acid of coenzyme γ-F420-2(5−) (CHEBI:57922) |
| Incoming Relation(s) |
| 1,5-dihydrocoenzyme F420 (CHEBI:15823) has functional parent coenzyme γ-F420-2 (CHEBI:16848) |
| coenzyme γ-F420-2(4−) (CHEBI:59541) is conjugate base of coenzyme γ-F420-2 (CHEBI:16848) |
| coenzyme γ-F420-2(5−) (CHEBI:57922) is conjugate base of coenzyme γ-F420-2 (CHEBI:16848) |
| IUPAC Name |
|---|
| N-(N-{O-[1-(8-hydroxy-2,4-dioxo-2,3,4,10-tetrahydropyrimido[4,5-b]quinolin-10-yl)-1-deoxy-D-ribityl-5-phospho]-(S)-lactyl}-γ-L-glutamyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| Coenzyme F420 | KEGG COMPOUND |
| COENZYME F420 | PDBeChem |
| coenzyme γ-F420-2 | ChEBI |
| N-{N-[O-(7,8-didemethyl-8-hydroxy-5-deazariboflavin phospho)-(S)-lactyl]-γ-L-glutamyl}-L-glutamate | IUBMB |
| factor F420 | ChEBI |
| F420 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:878051 | Beilstein |
| CAS:64885-97-8 | ChemIDplus |
| CAS:64885-97-8 | KEGG COMPOUND |
| Citations |
|---|