EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O9 |
| Net Charge | 0 |
| Average Mass | 460.479 |
| Monoisotopic Mass | 460.17333 |
| SMILES | COc1ccc([C@H]2C[C@@H]3O[C@H]4[C@H](Oc5c(C)c(O)c(C)c(c53)O2)O[C@H](CO)[C@@H](O)[C@@H]4O)cc1 |
| InChI | InChI=1S/C24H28O9/c1-10-18(26)11(2)22-17-15(31-23-20(28)19(27)16(9-25)32-24(23)33-22)8-14(30-21(10)17)12-4-6-13(29-3)7-5-12/h4-7,14-16,19-20,23-28H,8-9H2,1-3H3/t14-,15+,16-,19-,20+,23-,24+/m1/s1 |
| InChIKey | BVWNFYIRLQDZHV-WIGWAHHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abacopteris penangiana (IPNI:1136121-2) | aerial part (BTO:0001658) | DOI (10.1021/np0703850) | |
| Glaphyropteridopsis erubescens (ncbitaxon:173878) | - | DOI (10.1248/cpb.32.490) | |
| Pronephrium penangianum (ncbitaxon:1132560) | whole plant (BTO:0001461) | PubMed (26279445) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eruberin A (CHEBI:140078) has functional parent β-D-glucose (CHEBI:15903) |
| eruberin A (CHEBI:140078) has role antifibrotic agent (CHEBI:233423) |
| eruberin A (CHEBI:140078) has role antioxidant (CHEBI:22586) |
| eruberin A (CHEBI:140078) has role plant metabolite (CHEBI:76924) |
| eruberin A (CHEBI:140078) is a hydroxyflavan (CHEBI:72010) |
| eruberin A (CHEBI:140078) is a methoxybenzenes (CHEBI:51683) |
| eruberin A (CHEBI:140078) is a monosaccharide derivative (CHEBI:63367) |
| eruberin A (CHEBI:140078) is a organic heterotetracyclic compound (CHEBI:38163) |
| eruberin A (CHEBI:140078) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2R,7aS,9R,10S,11S,11aR,12aS)-9-(hydroxymethyl)-2-(4-methoxyphenyl)-4,6-dimethyl-1,9,10,11,11a,12a-hexahydro-2H,7aH-pyrano[2',3':2,3][1,4]dioxepino[5,6,7-de]chromene-5,10,11-triol |
| Synonym | Source |
|---|---|
| 1,2-O-[3,4-dihydro-7-hydroxy-2-(4-methoxyphenyl)-6,8-dimethyl-2H-1-benzopyran-5,4-diyl]-β-D-glucopyranose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10270537 | ChemSpider |
| C00008978 | KNApSAcK |
| LMPK12020167 | LIPID MAPS |
| US20140348965 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:90146-68-2 | KNApSAcK |
| Citations |
|---|