EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H47N11O9 |
| Net Charge | 0 |
| Average Mass | 861.917 |
| Monoisotopic Mass | 861.35582 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C43H47N11O9/c44-32(15-26-18-47-33-4-2-1-3-31(26)33)39(58)52-34(13-24-5-9-29(55)10-6-24)40(59)48-21-38(57)51-35(14-25-7-11-30(56)12-8-25)41(60)53-36(16-27-19-45-22-49-27)42(61)54-37(43(62)63)17-28-20-46-23-50-28/h1-12,18-20,22-23,32,34-37,47,55-56H,13-17,21,44H2,(H,45,49)(H,46,50)(H,48,59)(H,51,57)(H,52,58)(H,53,60)(H,54,61)(H,62,63)/t32-,34-,35-,36-,37-/m0/s1 |
| InChIKey | ZSSKZJBTPJBKFT-WZUXKDABSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Tyr-Gly-Tyr-His-His (CHEBI:140076) has role epitope (CHEBI:53000) |
| Trp-Tyr-Gly-Tyr-His-His (CHEBI:140076) is a hexapeptide (CHEBI:233722) |
| IUPAC Name |
|---|
| L-tryptophyl-L-tyrosylglycyl-L-tyrosyl-L-histidyl-L-histidine |
| Synonyms | Source |
|---|---|
| WYGYHH | ChEBI |
| W-Y-G-Y-H-H | ChEBI |
| L-Trp-L-Tyr-Gly-L-Tyr-L-His-L-His | ChEBI |
| Citations |
|---|