EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40N10O6 |
| Net Charge | 0 |
| Average Mass | 648.725 |
| Monoisotopic Mass | 648.31323 |
| SMILES | CCC(C)[C@H](NC(=O)CNC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C31H40N10O6/c1-3-17(2)27(41-26(42)14-36-28(43)22(32)8-18-11-35-23-7-5-4-6-21(18)23)30(45)39-24(9-19-12-33-15-37-19)29(44)40-25(31(46)47)10-20-13-34-16-38-20/h4-7,11-13,15-17,22,24-25,27,35H,3,8-10,14,32H2,1-2H3,(H,33,37)(H,34,38)(H,36,43)(H,39,45)(H,40,44)(H,41,42)(H,46,47)/t17?,22-,24-,25-,27-/m0/s1 |
| InChIKey | YNJBFSFTYAPMTA-FNINZLGVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Gly-Ile-His-His (CHEBI:140075) has role epitope (CHEBI:53000) |
| Trp-Gly-Ile-His-His (CHEBI:140075) is a pentapeptide (CHEBI:48545) |
| IUPAC Name |
|---|
| L-tryptophylglycyl-L-isoleucyl-L-histidyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-Trp-Gly-L-Ile-L-His-L-His | ChEBI |
| W-G-I-H-H | ChEBI |
| WGIHH | ChEBI |
| Citations |
|---|