EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H56N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1023.839 |
| Monoisotopic Mass | 1023.24628 |
| SMILES | C[C@@H]1O[C@@H](OCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C34H56N7O21P3S/c1-19-20(42)14-21(43)33(59-19)56-12-7-5-4-6-8-24(45)66-13-11-36-23(44)9-10-37-31(48)28(47)34(2,3)16-58-65(54,55)62-64(52,53)57-15-22-27(61-63(49,50)51)26(46)32(60-22)41-18-40-25-29(35)38-17-39-30(25)41/h6,8,17-22,26-28,32-33,42-43,46-47H,4-5,7,9-16H2,1-3H3,(H,36,44)(H,37,48)(H,52,53)(H,54,55)(H2,35,38,39)(H2,49,50,51)/b8-6+/t19-,20+,21+,22+,26+,27+,28-,32+,33+/m0/s1 |
| InChIKey | ZQRUHCIHYLDUGE-YAOUEKBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#7-CoA (CHEBI:140056) has functional parent oscr#7 (CHEBI:79132) |
| oscr#7-CoA (CHEBI:140056) is a acyl-CoA (CHEBI:17984) |
| oscr#7-CoA (CHEBI:140056) is conjugate acid of oscr#7-CoA(4−) (CHEBI:140057) |
| Incoming Relation(s) |
| oscr#7-CoA(4−) (CHEBI:140057) is conjugate base of oscr#7-CoA (CHEBI:140056) |
| Synonyms | Source |
|---|---|
| (2E)-7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hept-2-enoyl-CoA | ChEBI |
| (2E)-7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hept-2-enoyl-coenzyme A | ChEBI |
| oscr#7-coenzyme A | ChEBI |