EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21O6 |
| Net Charge | -1 |
| Average Mass | 273.305 |
| Monoisotopic Mass | 273.13436 |
| SMILES | C[C@@H]1O[C@@H](OCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H22O6/c1-9-10(14)8-11(15)13(19-9)18-7-5-3-2-4-6-12(16)17/h4,6,9-11,13-15H,2-3,5,7-8H2,1H3,(H,16,17)/p-1/b6-4+/t9-,10+,11+,13+/m0/s1 |
| InChIKey | PECXANWMSPKDGB-XROMHLQASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#7(1−) (CHEBI:140055) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#7(1−) (CHEBI:140055) is conjugate base of oscr#7 (CHEBI:79132) |
| Incoming Relation(s) |
| oscr#7 (CHEBI:79132) is conjugate acid of oscr#7(1−) (CHEBI:140055) |
| IUPAC Name |
|---|
| (2E)-7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hept-2-enoate |