EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H60N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1051.893 |
| Monoisotopic Mass | 1051.27758 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C36H60N7O21P3S/c1-21-22(44)16-23(45)35(61-21)58-14-9-7-5-4-6-8-10-26(47)68-15-13-38-25(46)11-12-39-33(50)30(49)36(2,3)18-60-67(56,57)64-66(54,55)59-17-24-29(63-65(51,52)53)28(48)34(62-24)43-20-42-27-31(37)40-19-41-32(27)43/h8,10,19-24,28-30,34-35,44-45,48-49H,4-7,9,11-18H2,1-3H3,(H,38,46)(H,39,50)(H,54,55)(H,56,57)(H2,37,40,41)(H2,51,52,53)/b10-8+/t21-,22+,23+,24+,28+,29+,30-,34+,35+/m0/s1 |
| InChIKey | HDPRLFGUCIUTAV-FVVVJHBGSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#3-CoA (CHEBI:140053) has functional parent oscr#3 (CHEBI:79131) |
| oscr#3-CoA (CHEBI:140053) is a acyl-CoA (CHEBI:17984) |
| oscr#3-CoA (CHEBI:140053) is conjugate acid of oscr#3-CoA(4−) (CHEBI:140054) |
| Incoming Relation(s) |
| oscr#3-CoA(4−) (CHEBI:140054) is conjugate base of oscr#3-CoA (CHEBI:140053) |
| Synonyms | Source |
|---|---|
| (2E)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]non-2-enoyl-CoA | ChEBI |
| (2E)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]non-2-enoyl-coenzyme A | ChEBI |
| oscr#3-coenzyme A | ChEBI |