EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O6 |
| Net Charge | -1 |
| Average Mass | 301.359 |
| Monoisotopic Mass | 301.16566 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H26O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h6,8,11-13,15-17H,2-5,7,9-10H2,1H3,(H,18,19)/p-1/b8-6+/t11-,12+,13+,15+/m0/s1 |
| InChIKey | CYRZSEWKKCHVSI-XHDDSBKUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#3(1−) (CHEBI:140025) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#3(1−) (CHEBI:140025) is conjugate base of oscr#3 (CHEBI:79131) |
| Incoming Relation(s) |
| oscr#3 (CHEBI:79131) is conjugate acid of oscr#3(1−) (CHEBI:140025) |
| IUPAC Name |
|---|
| (2E)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]non-2-enoate |