EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35O6 |
| Net Charge | -1 |
| Average Mass | 371.494 |
| Monoisotopic Mass | 371.24391 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O6/c1-16-17(21)15-18(22)20(26-16)25-14-12-10-8-6-4-2-3-5-7-9-11-13-19(23)24/h11,13,16-18,20-22H,2-10,12,14-15H2,1H3,(H,23,24)/p-1/b13-11+/t16-,17+,18+,20+/m0/s1 |
| InChIKey | DIYWZICECWKTIT-XKCSVMQCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#23(1−) (CHEBI:140004) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#23(1−) (CHEBI:140004) is conjugate base of oscr#23 (CHEBI:79145) |
| Incoming Relation(s) |
| oscr#23 (CHEBI:79145) is conjugate acid of oscr#23(1−) (CHEBI:140004) |
| IUPAC Name |
|---|
| (2E)-14-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]tetradec-2-enoate |