EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15393 - (+)-borneol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8+,10+/m1/s1 |
| InChIKey | DTGKSKDOIYIVQL-WEDXCCLWSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-borneol (CHEBI:15393) is a borneol (CHEBI:28093) |
| (+)-borneol (CHEBI:15393) is enantiomer of (−)-borneol (CHEBI:15394) |
| Incoming Relation(s) |
| (+)-bornyl acetate (CHEBI:3151) has functional parent (+)-borneol (CHEBI:15393) |
| (+)-bornyl diphosphate (CHEBI:15395) has functional parent (+)-borneol (CHEBI:15393) |
| (−)-borneol (CHEBI:15394) is enantiomer of (+)-borneol (CHEBI:15393) |
| IUPAC Name |
|---|
| (1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| Synonyms | Source |
|---|---|
| (1R,2S,4R)-borneol | ChemIDplus |
| (1R-endo)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol | ChemIDplus |
| (1R,2S,4R)-(+)-Borneol | KEGG COMPOUND |
| Borneocamphor | KEGG COMPOUND |
| (+)-Borneol | KEGG COMPOUND |
| d-Borneol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1R,2S,4R)-borneol | UniProt |