EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H33O6 |
| Net Charge | -1 |
| Average Mass | 357.467 |
| Monoisotopic Mass | 357.22826 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H34O6/c1-15-16(20)14-17(21)19(25-15)24-13-11-9-7-5-3-2-4-6-8-10-12-18(22)23/h10,12,15-17,19-21H,2-9,11,13-14H2,1H3,(H,22,23)/p-1/b12-10+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | DEQPIGLSNWHDFR-VATKAKJBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#21(1−) (CHEBI:139998) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#21(1−) (CHEBI:139998) is conjugate base of oscr#21 (CHEBI:79143) |
| Incoming Relation(s) |
| oscr#21 (CHEBI:79143) is conjugate acid of oscr#21(1−) (CHEBI:139998) |
| IUPAC Name |
|---|
| (2E)-13-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]tridec-2-enoate |