EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29O6 |
| Net Charge | -1 |
| Average Mass | 329.413 |
| Monoisotopic Mass | 329.19696 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H30O6/c1-13-14(18)12-15(19)17(23-13)22-11-9-7-5-3-2-4-6-8-10-16(20)21/h8,10,13-15,17-19H,2-7,9,11-12H2,1H3,(H,20,21)/p-1/b10-8+/t13-,14+,15+,17+/m0/s1 |
| InChIKey | FDWVWTCEWSMDGI-DSKDDBFVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#17(1−) (CHEBI:139984) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#17(1−) (CHEBI:139984) is conjugate base of oscr#17 (CHEBI:79139) |
| Incoming Relation(s) |
| oscr#17 (CHEBI:79139) is conjugate acid of oscr#17(1−) (CHEBI:139984) |
| IUPAC Name |
|---|
| (2E)-11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undec-2-enoate |