EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27O6 |
| Net Charge | -1 |
| Average Mass | 315.386 |
| Monoisotopic Mass | 315.18131 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H28O6/c1-12-13(17)11-14(18)16(22-12)21-10-8-6-4-2-3-5-7-9-15(19)20/h7,9,12-14,16-18H,2-6,8,10-11H2,1H3,(H,19,20)/p-1/b9-7+/t12-,13+,14+,16+/m0/s1 |
| InChIKey | LNUSDHULQVPZFO-RYJVCDSQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#15(1−) (CHEBI:139978) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#15(1−) (CHEBI:139978) is conjugate base of oscr#15 (CHEBI:79137) |
| Incoming Relation(s) |
| oscr#15 (CHEBI:79137) is conjugate acid of oscr#15(1−) (CHEBI:139978) |
| IUPAC Name |
|---|
| (2E)-10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]dec-2-enoate |