EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23O6 |
| Net Charge | -1 |
| Average Mass | 275.321 |
| Monoisotopic Mass | 275.15001 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H24O6/c1-9-10(14)8-11(15)13(19-9)18-7-5-3-2-4-6-12(16)17/h9-11,13-15H,2-8H2,1H3,(H,16,17)/p-1/t9-,10+,11+,13+/m0/s1 |
| InChIKey | XHPJAFLLEKUEFS-SBFPOUOMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#1(1−) (CHEBI:139964) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#1(1−) (CHEBI:139964) is conjugate base of oscr#1 (CHEBI:79130) |
| Incoming Relation(s) |
| oscr#1 (CHEBI:79130) is conjugate acid of oscr#1(1−) (CHEBI:139964) |
| IUPAC Name |
|---|
| 7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoate |