EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27O7 |
| Net Charge | -1 |
| Average Mass | 319.374 |
| Monoisotopic Mass | 319.17623 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCC[C@@H](O)CC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O7/c1-10-12(17)9-13(18)15(22-10)21-7-5-3-2-4-6-11(16)8-14(19)20/h10-13,15-18H,2-9H2,1H3,(H,19,20)/p-1/t10-,11+,12+,13+,15+/m0/s1 |
| InChIKey | DGLIIKDKPYKHDK-KMCWBVRRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhos#10(1-) (CHEBI:139774) is a organic molecular entity (CHEBI:50860) |
| bhos#10(1-) (CHEBI:139774) is conjugate base of bhos#10 (CHEBI:79256) |
| Incoming Relation(s) |
| bhos#10 (CHEBI:79256) is conjugate acid of bhos#10(1-) (CHEBI:139774) |