EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25O6 |
| Net Charge | -1 |
| Average Mass | 289.348 |
| Monoisotopic Mass | 289.16566 |
| SMILES | C[C@H](CCCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C14H26O6/c1-9(6-4-3-5-7-13(17)18)19-14-12(16)8-11(15)10(2)20-14/h9-12,14-16H,3-8H2,1-2H3,(H,17,18)/p-1/t9-,10+,11-,12-,14-/m1/s1 |
| InChIKey | HRHMWTOQBKRTTG-CYRBOEJBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#14(1−) (CHEBI:139627) is a monocarboxylic acid anion (CHEBI:35757) |
| ascr#14(1−) (CHEBI:139627) is conjugate base of ascr#14 (CHEBI:78905) |
| Incoming Relation(s) |
| ascr#14 (CHEBI:78905) is conjugate acid of ascr#14(1−) (CHEBI:139627) |
| IUPAC Name |
|---|
| (7R)-7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octanoate |
| Synonyms | Source |
|---|---|
| asc-C8 anion | ChEBI |
| asc-C8(1−) | ChEBI |
| ascr#14 anion | ChEBI |