EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C20H19N4O3 |
| Net Charge | 0 |
| Average Mass | 443.301 |
| Monoisotopic Mass | 442.06405 |
| SMILES | COCCn1c2c([n+](Cc3cnccn3)c1C)C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C20H19N4O3.BrH/c1-13-23(9-10-27-2)17-18(24(13)12-14-11-21-7-8-22-14)20(26)16-6-4-3-5-15(16)19(17)25;/h3-8,11H,9-10,12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QBIYUDDJPRGKNJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. survivin suppressant An apoptosis inducer that works by selectively inhibiting survivin (BIRC5) gene promoter activity so as to down-regulate survivin, a protein that inhibits apoptosis, so leading to induction of apoptosis. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sepantronium bromide (CHEBI:139608) has part sepantronium (CHEBI:94552) |
| sepantronium bromide (CHEBI:139608) has role antineoplastic agent (CHEBI:35610) |
| sepantronium bromide (CHEBI:139608) has role apoptosis inducer (CHEBI:68495) |
| sepantronium bromide (CHEBI:139608) has role survivin suppressant (CHEBI:139609) |
| sepantronium bromide (CHEBI:139608) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| 1-(2-methoxyethyl)-2-methyl-4,9-dioxo-3-(pyrazin-2-ylmethyl)-4,9-dihydro-1H-naphtho[2,3-d]imidazol-3-ium bromide |
| INNs | Source |
|---|---|
| bromuro de sepantronio | WHO MedNet |
| sepantronii bromidum | WHO MedNet |
| bromure de sépantronium | WHO MedNet |
| sepantronium bromide | WHO MedNet |
| Synonyms | Source |
|---|---|
| YM 155 | ChemIDplus |
| YM-155 | ChemIDplus |
| 3-(2-methoxyethyl)-2-methyl-4,9-dioxo-1-(pyrazin-2-ylmethyl)-4,9-dihydro-1H-naphtho[2,3-d]imidazol-3-ium bromide | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:781661-94-7 | ChemIDplus |
| Citations |
|---|