EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52O9 |
| Net Charge | 0 |
| Average Mass | 592.770 |
| Monoisotopic Mass | 592.36113 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C33H52O9/c1-18(8-6-14-32(3,4)42-31-28(38)26(36)27(37)29(41-31)30(39)40)23-12-13-24-20(9-7-15-33(23,24)5)10-11-21-16-22(34)17-25(35)19(21)2/h10-11,18,22-29,31,34-38H,2,6-9,12-17H2,1,3-5H3,(H,39,40)/b20-10+,21-11-/t18-,22-,23-,24+,25+,26+,27+,28-,29+,31+,33-/m1/s1 |
| InChIKey | UBEXJJQDSPZXNL-BHNPUNFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | liver (BTO:0000759) | PubMed (18177842) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) has functional parent calcitriol (CHEBI:17823) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) has role human xenobiotic metabolite (CHEBI:76967) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) is a D3 vitamins (CHEBI:73558) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) is a steroid glucosiduronic acid (CHEBI:26763) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) is a β-D-glucosiduronic acid (CHEBI:15341) |
| calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) is conjugate acid of calcitriol 25-O-(β-D-glucuronate) (CHEBI:139274) |
| Incoming Relation(s) |
| calcitriol 25-O-(β-D-glucuronate) (CHEBI:139274) is conjugate base of calcitriol 25-O-(β-D-glucuronide) (CHEBI:139600) |
| IUPAC Name |
|---|
| (6R)-6-[(1R,3aS,4E,7aR)-4-{(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyloctahydro-1H-inden-1-yl]-2-methylheptan-2-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| calcitriol 25-O--(β-D-glucuronic acid) | ChEBI |
| 1α,25-dihydroxyvitamin D3 25-O-(β-D-glucuronic acid) | ChEBI |
| 1α,25-dihydroxyvitamin D3 25-O-(β-D-glucuronide) | ChEBI |
| calcitriol 25-glucuronide | ChEBI |
| calcitriol 25-β-glucuronide | ChEBI |
| (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diol-25-yl β-D-glucopyranosiduronic acid | ChEBI |
| Citations |
|---|