EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | NC[C@H]1CC[C@H](C(=O)Oc2ccc(CCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C17H23NO4/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20)/t13-,14- |
| InChIKey | FHRSHSOEWXUORL-HDJSIYSDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. drug Any substance which when absorbed into a living organism may modify one or more of its functions. The term is generally accepted for a substance taken for a therapeutic purpose, but is also commonly used for abused substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cetraxate (CHEBI:17340) has role anti-ulcer drug (CHEBI:49201) |
| cetraxate (CHEBI:17340) is a cetraxates (CHEBI:23084) |
| cetraxate (CHEBI:17340) is tautomer of cetraxate zwitterion (CHEBI:58112) |
| Incoming Relation(s) |
| cetraxate zwitterion (CHEBI:58112) is tautomer of cetraxate (CHEBI:17340) |
| IUPAC Name |
|---|
| 3-[4-({[(1r,4r)-4-(aminomethyl)cyclohexyl]carbonyl}oxy)phenyl]propanoic acid |
| Synonyms | Source |
|---|---|
| 3-[4-({[trans-4-(aminomethyl)cyclohexyl]carbonyl}oxy)phenyl]propanoic acid | IUPAC |
| Cetraxate | KEGG COMPOUND |
| p-hydroxyhydrocinnamic acid trans-(4-aminomethyl)cyclohexanecarboxylate | ChemIDplus |
| trans-4-(((4-(aminomethyl)cyclohexyl)carbonyl)oxy)benzenepropanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2820321 | Reaxys |
| CAS:34675-84-8 | ChemIDplus |
| Citations |
|---|