EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N4 |
| Net Charge | 0 |
| Average Mass | 378.564 |
| Monoisotopic Mass | 378.27835 |
| SMILES | CCCCN(CC)c1nc(C)nc2c1c(C)c(C)n2-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H34N4/c1-9-11-12-27(10-2)23-21-18(6)19(7)28(24(21)26-20(8)25-23)22-16(4)13-15(3)14-17(22)5/h13-14H,9-12H2,1-8H3 |
| InChIKey | IXPROWGEHNVJOY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | corticotropin-releasing factor receptor antagonist A hormone antagonist that blocks corticotropin-releasing factor receptors |
| Application: | corticotropin-releasing factor receptor antagonist A hormone antagonist that blocks corticotropin-releasing factor receptors |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antalarmin (CHEBI:139557) has role corticotropin-releasing factor receptor antagonist (CHEBI:76977) |
| antalarmin (CHEBI:139557) is a pyrrolopyrimidine (CHEBI:38670) |
| antalarmin (CHEBI:139557) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-butyl-N-ethyl-7-mesityl-2,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Manual Xrefs | Databases |
|---|---|
| Antalarmin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:157284-96-3 | ChemIDplus |
| Citations |
|---|