EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H79O10P |
| Net Charge | 0 |
| Average Mass | 775.058 |
| Monoisotopic Mass | 774.54109 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](O)COP(=O)(O)OC[C@@H](O)COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H79O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(45)49-35-39(43)37-51-53(47,48)52-38-40(44)36-50-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,39-40,43-44H,3-16,21-38H2,1-2H3,(H,47,48)/b19-17-,20-18-/t39-,40-/m0/s1 |
| InChIKey | GNCZTBXGLUHKAP-JOZUOZHYSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-bis-(3-oleoylglycero)-1-phosphate (CHEBI:139539) has functional parent oleic acid (CHEBI:16196) |
| (S,S)-bis-(3-oleoylglycero)-1-phosphate (CHEBI:139539) is a 2,2'-lysobisphosphatidic acid (CHEBI:60818) |
| (S,S)-bis-(3-oleoylglycero)-1-phosphate (CHEBI:139539) is conjugate acid of (S,S)-bis-(3-oleoylglycero)-1-phosphate(1−) (CHEBI:139150) |
| Incoming Relation(s) |
| (S,S)-bis-(3-oleoylglycero)-1-phosphate(1−) (CHEBI:139150) is conjugate base of (S,S)-bis-(3-oleoylglycero)-1-phosphate (CHEBI:139539) |
| IUPAC Name |
|---|
| (hydroxyphosphoryl)bis[oxy(2S)-2-hydroxypropane-3,1-diyl] (9Z,9'Z)di-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| (S,S) 18:1(9Z) BMP | ChEBI |
| (S,S)-bis-[3-(9Z-octadecenoyl)-sn-glycero]-1-phosphate | ChEBI |
| (S,S)-bis-[3-(9Z-octadecenoyl)glycero]-1-phosphate | ChEBI |
| (S,S)-bis-(3-oleoyl-sn-glycero)-1-phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28957883 | Reaxys |
| Citations |
|---|