EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C/C1=C/C=C(/C(C)C)CC/C(C)=C/CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,14,16H,6-7,9-10,13,15H2,1-5H3/b17-8+,18-12-,19-11+,20-14+ |
| InChIKey | UJUWZMUCEGGBOH-FAZZLAFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus koraiensis (ncbitaxon:88728) | - | Article (Chem Nat Compd (1971) 7: 582) | Isolated from the oleoresin |
| Pinus sibirica (ncbitaxon:62752) | - | Article (Chem Nat Compd (1971) 7: 582) | Isolated from the oleoresin |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-pinacene (CHEBI:139494) has role plant metabolite (CHEBI:76924) |
| beta-pinacene (CHEBI:139494) is a diterpene (CHEBI:35190) |
| beta-pinacene (CHEBI:139494) is a macrocycle (CHEBI:51026) |
| beta-pinacene (CHEBI:139494) is a monocyclic hydrocarbon (CHEBI:33664) |
| IUPAC Name |
|---|
| (1Z,3E,7E,11E)-4-isopropyl-1,7,11-trimethylcyclotetradeca-1,3,7,11-tetraene |
| Synonym | Source |
|---|---|
| 1(14)E,2Z,6E,10E-14-isopropyl-3,7,11-trimethylcyclotetradeca-1(14),3,7,11-tetraene | ChEBI |
| UniProt Name | Source |
|---|---|
| β-pinacene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB019348 | FooDB |
| Citations |
|---|