EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:139481 - 5-chloro-L-tryptophan
| Formula | C11H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 238.674 |
| Monoisotopic Mass | 238.05091 |
| SMILES | N[C@@H](Cc1cnc2ccc(Cl)cc12)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | TUKKZLIDCNWKIN-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-L-tryptophan (CHEBI:139481) is a L-tryptophan derivative (CHEBI:47994) |
| 5-chloro-L-tryptophan (CHEBI:139481) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 5-chloro-L-tryptophan (CHEBI:139481) is a organochlorine compound (CHEBI:36683) |
| 5-chloro-L-tryptophan (CHEBI:139481) is tautomer of 5-chloro-L-tryptophan zwitterion (CHEBI:139332) |
| Incoming Relation(s) |
| 5-chloro-L-tryptophan zwitterion (CHEBI:139332) is tautomer of 5-chloro-L-tryptophan (CHEBI:139481) |
| IUPAC Name |
|---|
| 5-chloro-L-tryptophan |
| Synonyms | Source |
|---|---|
| (2S)-2-azanyl-3-(5-chloranyl-1H-indol-3-yl)propanoic acid | PDBeChem |
| 5'-chloro-L-tryptophan | ChEBI |
| Citations |
|---|